cas: 5470-65-5 — see every product listed under this CAS number, including other names
3-Bromo-4-nitrophenol, 97% (CAS 5470-65-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211021-5G |
| cas | 5470-65-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 909.07 Pln | |
| Fluorochem | 100g | 3205.14 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-bromo-4-nitrophenol (CAS 5470-65-5) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 3-bromo-4-nitrophenol. InChIKey: SZYVPWPBRABKAB-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 3-bromo-4-nitrophenol |
| InChIKey | SZYVPWPBRABKAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)