cas: 174184-13-5 — see every product listed under this CAS number, including other names
3-Bromo-4-oxo-piperidine-1-carboxylic acid benzyl ester, 95% (CAS 174184-13-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F075394-1G |
| cas | 174184-13-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 565.44 Pln | |
| Fluorochem | 5g | 1893.10 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl 3-bromo-4-oxopiperidine-1-carboxylate (CAS 174184-13-5) is a chemical compound with the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. IUPAC name: benzyl 3-bromo-4-oxopiperidine-1-carboxylate. InChIKey: HIJNDCHNTWYMKT-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO3 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | benzyl 3-bromo-4-oxopiperidine-1-carboxylate |
| InChIKey | HIJNDCHNTWYMKT-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1=O)Br)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)