cas: 174184-13-5 — see every product listed under this CAS number, including other names
Benzyl 3-bromo-4-oxopiperidine-1-carboxylate, 98%, 98% (CAS 174184-13-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BA8M-100mg |
| cas | 174184-13-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 558.80 Pln | |
| Chemat | 5g | 1883.60 Pln | |
| Chemat | 10g | 3525.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-bromo-4-oxopiperidine-1-carboxylate (CAS 174184-13-5) is a chemical compound with the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. IUPAC name: benzyl 3-bromo-4-oxopiperidine-1-carboxylate. InChIKey: HIJNDCHNTWYMKT-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO3 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | benzyl 3-bromo-4-oxopiperidine-1-carboxylate |
| InChIKey | HIJNDCHNTWYMKT-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1=O)Br)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)