cas: 855198-27-5 — see every product listed under this CAS number, including other names
3-Bromo-5-ethoxybenzoic acid (CAS 855198-27-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632567-1G |
| cas | 855198-27-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1174.60 Pln | |
| Fluorochem | 5g | 3392.57 Pln |
| delivery time | 3-4 weeks |
|---|
3-bromo-5-ethoxybenzoic acid (CAS 855198-27-5) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 3-bromo-5-ethoxybenzoic acid. InChIKey: DMIGIIGQWXKUKM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 3-bromo-5-ethoxybenzoic acid |
| InChIKey | DMIGIIGQWXKUKM-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)