3-Bromo-5-nitrophenol, 95%
cas: 116632-23-6 — see every product listed under this CAS number, including other names
3-Bromo-5-nitrophenol, 95% (CAS 116632-23-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F222565-100MG |
| cas | 116632-23-6 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 242.64 Pln | |
| Fluorochem | 10g | 393.63 Pln | |
| Fluorochem | 25g | 794.53 Pln | |
| Fluorochem | 50g | 1528.65 Pln | |
| Fluorochem | 100g | 2944.81 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 403.75 Pln | |
| Ambeed | 25g | 776.44 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3-bromo-5-nitrophenol (CAS 116632-23-6) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 3-bromo-5-nitrophenol. InChIKey: VJQGLUHOAIZTNK-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 3-bromo-5-nitrophenol |
| InChIKey | VJQGLUHOAIZTNK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)