cas: 142137-17-5 — see every product listed under this CAS number, including other names
3-Bromo-5-phenylpyridine, 98% (CAS 142137-17-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F067249-250MG |
| cas | 142137-17-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 799.74 Pln | |
| Fluorochem | 10g | 1544.27 Pln | |
| Fluorochem | 25g | 3777.85 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-bromo-5-phenylpyridine (CAS 142137-17-5) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 3-bromo-5-phenylpyridine. InChIKey: AWCQJXPOCRXHNK-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 3-bromo-5-phenylpyridine |
| InChIKey | AWCQJXPOCRXHNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)