cas: 1426073-21-3 — see every product listed under this CAS number, including other names
3-Bromo-6-fluoro-2-methoxybenzoic acid, 95%, 95% (CAS 1426073-21-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C4UA-50mg |
| cas | 1426073-21-3 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 616.40 Pln | |
| Chemat | 100mg | 899.60 Pln | |
| Chemat | 250mg | 1245.20 Pln | |
| Chemat | 1g | 2450.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-6-fluoro-2-methoxybenzoic acid (CAS 1426073-21-3) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 3-bromo-6-fluoro-2-methoxybenzoic acid. InChIKey: WRSPJCQSBRAYCE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 3-bromo-6-fluoro-2-methoxybenzoic acid |
| InChIKey | WRSPJCQSBRAYCE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1C(=O)O)F)Br |
Computed by PubChem (NCBI)