CAS 1254340-71-0 appears in our catalog under these names: 3-Bromo-5-fluoro-2-methoxybenzoic acid, 95%, 3-Bromo-5-fluoro-2-methoxybenzoic acid, 97%, 3-Bromo-5-fluoro-2-methoxybenzoic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
3-bromo-5-fluoro-2-methoxybenzoic acid (CAS 1254340-71-0) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 3-bromo-5-fluoro-2-methoxybenzoic acid. InChIKey: INHOLDZRDCHUFE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 3-bromo-5-fluoro-2-methoxybenzoic acid |
| InChIKey | INHOLDZRDCHUFE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)F)C(=O)O |
Computed by PubChem (NCBI)