Products 1782905-40-1
CAS 1782905-40-1 appears in our catalog under these names: 2-Bromo-6-fluorophenoxyacetic acid, 98%, 2-(2-Bromo-6-fluorophenoxy)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
2-(2-bromo-6-fluorophenoxy)acetic acid (CAS 1782905-40-1) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 2-(2-bromo-6-fluorophenoxy)acetic acid. InChIKey: ZSWFWYLIUGUFHJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 2-(2-bromo-6-fluorophenoxy)acetic acid |
| InChIKey | ZSWFWYLIUGUFHJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OCC(=O)O)F |
Computed by PubChem (NCBI)