cas: 5341-07-1 — see every product listed under this CAS number, including other names
3-Bromo-8-nitroquinoline 97% (CAS 5341-07-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A400095-250mg |
| cas | 5341-07-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 1115.75 Pln | |
| Ambeed | 10g | 1900.06 Pln | |
| Ambeed | 25g | 3730.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A400095 |
3-bromo-8-nitroquinoline (CAS 5341-07-1) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 3-bromo-8-nitroquinoline. InChIKey: DTXRHWZDVULKEJ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 3-bromo-8-nitroquinoline |
| InChIKey | DTXRHWZDVULKEJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)