cas: 607371-01-7 — see every product listed under this CAS number, including other names
3-Bromo-N-ethyl-5-nitropyridin-4-amine (CAS 607371-01-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11484U-1g |
| cas | 607371-01-7 |
| size | 1g |
| availability | 33.47g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 12050.00 Pln | |
| Fluorochem | 1g | 19933.62 Pln |
| delivery time | 3 weeks |
|---|
3-bromo-N-ethyl-5-nitropyridin-4-amine (CAS 607371-01-7) is a chemical compound with the molecular formula C7H8BrN3O2 and a molecular weight of 246.06 g/mol. IUPAC name: 3-bromo-N-ethyl-5-nitropyridin-4-amine. InChIKey: DCRXFLDXMBGJNE-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O2 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 3-bromo-N-ethyl-5-nitropyridin-4-amine |
| InChIKey | DCRXFLDXMBGJNE-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=NC=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)