Products 261762-54-3
CAS 261762-54-3 appears in our catalog under these names: 2-(2-Chloro-3,6-difluorophenyl)acetonitrile, 95+%, 2-Chloro-3,6-difluorophenylacetonitrile. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g.
2-(2-chloro-3,6-difluorophenyl)acetonitrile (CAS 261762-54-3) is a chemical compound with the molecular formula C8H4ClF2N and a molecular weight of 187.57 g/mol. IUPAC name: 2-(2-chloro-3,6-difluorophenyl)acetonitrile. InChIKey: GXDOFQJKWADWAG-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2N |
|---|---|
| Molecular weight | 187.57 g/mol |
| IUPAC name | 2-(2-chloro-3,6-difluorophenyl)acetonitrile |
| InChIKey | GXDOFQJKWADWAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)CC#N)Cl)F |
Computed by PubChem (NCBI)