CAS 40626-54-8 is the registry number for 2-(4-Chlorophenyl)-2,2-difluoroacetonitrile, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(4-chlorophenyl)-2,2-difluoroacetonitrile (CAS 40626-54-8) is a chemical compound with the molecular formula C8H4ClF2N and a molecular weight of 187.57 g/mol. IUPAC name: 2-(4-chlorophenyl)-2,2-difluoroacetonitrile. InChIKey: AHAMRCBTHOZEAC-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2N |
|---|---|
| Molecular weight | 187.57 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2,2-difluoroacetonitrile |
| InChIKey | AHAMRCBTHOZEAC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C#N)(F)F)Cl |
Computed by PubChem (NCBI)