Products 1373920-84-3
CAS 1373920-84-3 is the registry number for 6-Chloro-2,3-difluorophenylacetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(6-chloro-2,3-difluorophenyl)acetonitrile (CAS 1373920-84-3) is a chemical compound with the molecular formula C8H4ClF2N and a molecular weight of 187.57 g/mol. IUPAC name: 2-(6-chloro-2,3-difluorophenyl)acetonitrile. InChIKey: DZNGMYTZQJRVAF-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2N |
|---|---|
| Molecular weight | 187.57 g/mol |
| IUPAC name | 2-(6-chloro-2,3-difluorophenyl)acetonitrile |
| InChIKey | DZNGMYTZQJRVAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)CC#N)Cl |
Computed by PubChem (NCBI)