cas: 2121515-11-3 — see every product listed under this CAS number, including other names
3-Chloro-2,4-dimethylphenylboronic acid (CAS 2121515-11-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627455-5G |
| cas | 2121515-11-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 13139.14 Pln | |
| Fluorochem | 1g | 4423.46 Pln |
| delivery time | 3-4 weeks |
|---|
(3-chloro-2,4-dimethylphenyl)boronic acid (CAS 2121515-11-3) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: (3-chloro-2,4-dimethylphenyl)boronic acid. InChIKey: RZWIRIWFGDHDJC-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | (3-chloro-2,4-dimethylphenyl)boronic acid |
| InChIKey | RZWIRIWFGDHDJC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C)Cl)C)(O)O |
Computed by PubChem (NCBI)