cas: 749875-02-3 — see every product listed under this CAS number, including other names
3-Chloro-2-(trifluoromethyl)isonicotinic acid 95% (CAS 749875-02-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A719582-100mg |
| cas | 749875-02-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 576.19 Pln | |
| Ambeed | 1g | 1132.44 Pln | |
| Ambeed | 5g | 5382.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A719582 |
3-chloro-2-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 749875-02-3) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 3-chloro-2-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: UVJBNXZJTBKRQB-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 3-chloro-2-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | UVJBNXZJTBKRQB-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)