cas: 261763-02-4 — see every product listed under this CAS number, including other names
3-Chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde 96% (CAS 261763-02-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193332-1g |
| cas | 261763-02-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 242.44 Pln | |
| Ambeed | 25g | 926.62 Pln | |
| Ambeed | 100g | 3502.06 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A193332 |
3-chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde (CAS 261763-02-4) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 3-chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde. InChIKey: MSZTVIFIFJCNRQ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 3-chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde |
| InChIKey | MSZTVIFIFJCNRQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)