cas: 4771-47-5 — see every product listed under this CAS number, including other names
3-Chloro-2-nitrobenzoic acid 95% (CAS 4771-47-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A227946-1g |
| cas | 4771-47-5 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 565.06 Pln | |
| Ambeed | 500g | 2428.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A227946 |
3-chloro-2-nitrobenzoic acid (CAS 4771-47-5) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 3-chloro-2-nitrobenzoic acid. InChIKey: VCHSXYHBMFKRBK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 3-chloro-2-nitrobenzoic acid |
| InChIKey | VCHSXYHBMFKRBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)