3-Chloro-4-ethoxybenzoic acid, 98%
cas: 213598-15-3 — see every product listed under this CAS number, including other names
3-Chloro-4-ethoxybenzoic acid, 98% (CAS 213598-15-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F314726-100MG |
| cas | 213598-15-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 117.68 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 398.84 Pln | |
| Fluorochem | 5g | 679.99 Pln | |
| Fluorochem | 10g | 1273.53 Pln | |
| Fluorochem | 25g | 3074.98 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 665.19 Pln | |
| Ambeed | 10g | 1232.56 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 818.00 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3-chloro-4-ethoxybenzoic acid (CAS 213598-15-3) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 3-chloro-4-ethoxybenzoic acid. InChIKey: VGMJYTDQPWANJQ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 3-chloro-4-ethoxybenzoic acid |
| InChIKey | VGMJYTDQPWANJQ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)