CAS 213598-15-3 appears in our catalog under these names: 3–Chloro–4–ethoxybenzoic acid, 3-Chloro-4-ethoxybenzoic acid, 95%, 3-Chloro-4-ethoxybenzoic acid 98%, 3-Chloro-4-ethoxybenzoic acid, 98%, 3-Chloro-4-Ethoxybenzoic Acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 25g.
3-chloro-4-ethoxybenzoic acid (CAS 213598-15-3) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 3-chloro-4-ethoxybenzoic acid. InChIKey: VGMJYTDQPWANJQ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 3-chloro-4-ethoxybenzoic acid |
| InChIKey | VGMJYTDQPWANJQ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)