cas: 402-11-9 — see every product listed under this CAS number, including other names
3-Chloro-4-nitrobenzotrifluoride, 98% (CAS 402-11-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009097-5G |
| cas | 402-11-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 10g | 456.11 Pln | |
| Fluorochem | 25g | 950.72 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-1-nitro-4-(trifluoromethyl)benzene (CAS 402-11-9) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 2-chloro-1-nitro-4-(trifluoromethyl)benzene. InChIKey: CZWWSPDHNLAYRJ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 2-chloro-1-nitro-4-(trifluoromethyl)benzene |
| InChIKey | CZWWSPDHNLAYRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)