3-Chloro-5-nitrobenzoic acid, 96%
cas: 34662-36-7 — see every product listed under this CAS number, including other names
3-Chloro-5-nitrobenzoic acid, 96% (CAS 34662-36-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F317999-1G |
| cas | 34662-36-7 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 279.09 Pln | |
| Fluorochem | 10g | 487.35 Pln | |
| Fluorochem | 25g | 1065.27 Pln | |
| Fluorochem | 100g | 3970.49 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
3-chloro-5-nitrobenzoic acid (CAS 34662-36-7) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 3-chloro-5-nitrobenzoic acid. InChIKey: YLQAJBKACBLUCM-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 3-chloro-5-nitrobenzoic acid |
| InChIKey | YLQAJBKACBLUCM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)