cas: 612-59-9 — see every product listed under this CAS number, including other names
3-Chloroquinoline 98% (CAS 612-59-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A168743-100mg |
| cas | 612-59-9 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 648.50 Pln | |
| Ambeed | 10g | 1115.75 Pln | |
| Ambeed | 25g | 2267.19 Pln | |
| Ambeed | 100g | 8864.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A168743 |
3-chloroquinoline (CAS 612-59-9) is a chemical compound with the molecular formula C9H6ClN and a molecular weight of 163.60 g/mol. IUPAC name: 3-chloroquinoline. InChIKey: FLORQCMDMHHIHN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | 3-chloroquinoline |
| InChIKey | FLORQCMDMHHIHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)Cl |
Computed by PubChem (NCBI)