CAS 612-59-9 appears in our catalog under these names: 3–Chloroquinoline, 3-Chloroquinoline 98%, 3-Chloroquinoline, 98%, 98%, 3-Chloroquinoline, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 25g, 100g.
3-chloroquinoline (CAS 612-59-9) is a chemical compound with the molecular formula C9H6ClN and a molecular weight of 163.60 g/mol. IUPAC name: 3-chloroquinoline. InChIKey: FLORQCMDMHHIHN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | 3-chloroquinoline |
| InChIKey | FLORQCMDMHHIHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)Cl |
Computed by PubChem (NCBI)