Products 1163141-57-8
CAS 1163141-57-8 appears in our catalog under these names: 3-Cyano-5-hydroxybenzoic acid, 3-Cyano-5-hydroxybenzoic acid, 95%, 95%, 3-Cyano-5-hydroxybenzoic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
3-cyano-5-hydroxybenzoic acid (CAS 1163141-57-8) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 3-cyano-5-hydroxybenzoic acid. InChIKey: AIJZBNIPPCUFCO-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 3-cyano-5-hydroxybenzoic acid |
| InChIKey | AIJZBNIPPCUFCO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)O)C#N |
Computed by PubChem (NCBI)