cas: 35193-44-3 — see every product listed under this CAS number, including other names
3-ETHYL-2-NITROBENZOIC ACID, 98% (CAS 35193-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F844173-100MG |
| cas | 35193-44-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 633.13 Pln | |
| Fluorochem | 250mg | 1294.35 Pln | |
| Fluorochem | 1g | 2481.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-ethyl-2-nitrobenzoic acid (CAS 35193-44-3) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 3-ethyl-2-nitrobenzoic acid. InChIKey: JFOWATROJMCOHF-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 3-ethyl-2-nitrobenzoic acid |
| InChIKey | JFOWATROJMCOHF-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)