cas: 762286-31-7 — see every product listed under this CAS number, including other names
3-Fluoro-2,4-dimethylphenylboronic acid (CAS 762286-31-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627995-1G |
| cas | 762286-31-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3939.26 Pln | |
| Fluorochem | 5g | 11665.70 Pln |
| delivery time | 3-4 weeks |
|---|
(3-fluoro-2,4-dimethylphenyl)boronic acid (CAS 762286-31-7) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (3-fluoro-2,4-dimethylphenyl)boronic acid. InChIKey: WVMGJPPIHJAPAG-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO2 |
|---|---|
| Molecular weight | 167.98 g/mol |
| IUPAC name | (3-fluoro-2,4-dimethylphenyl)boronic acid |
| InChIKey | WVMGJPPIHJAPAG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C)F)C)(O)O |
Computed by PubChem (NCBI)