cas: 261951-82-0 — see every product listed under this CAS number, including other names
3-Fluoro-2-(trifluoromethyl)benzoyl chloride, 97+% (CAS 261951-82-0) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A539703-10g |
| cas | 261951-82-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12002.83 Pln |
| purity | 97+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-fluoro-2-(trifluoromethyl)benzoyl chloride (CAS 261951-82-0) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 3-fluoro-2-(trifluoromethyl)benzoyl chloride. InChIKey: FHWMGBNKQOJFOJ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 3-fluoro-2-(trifluoromethyl)benzoyl chloride |
| InChIKey | FHWMGBNKQOJFOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)