cas: 458532-88-2 — see every product listed under this CAS number, including other names
3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%, 98% (CAS 458532-88-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 1kg, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JFE-250mg |
| cas | 458532-88-2 |
| size | 250mg |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 333.20 Pln | |
| Chemat | 25g | 650.00 Pln | |
| Chemat | 100g | 1994.00 Pln | |
| Chemat | 1kg | 9035.60 Pln | |
| Chemat | 500g | 7550.40 Pln | |
| Chemat | 5kg | 38126.40 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 458532-88-2) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: MLFGHAHGSVFKMI-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | MLFGHAHGSVFKMI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2)F |
Computed by PubChem (NCBI)