cas: 458532-88-2 — see every product listed under this CAS number, including other names
3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 99.66% (CAS 458532-88-2) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g, 1 g, 25 g, 100 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008147-10 g |
| cas | 458532-88-2 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 598.33 Pln | |
| MedChemExpress | 5 g | 431.15 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 25 g | 1053.44 Pln | |
| MedChemExpress | 100 g | 3263.99 Pln | |
| MedChemExpress | 50 g | 1917.23 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.66% |
3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 458532-88-2) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: MLFGHAHGSVFKMI-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | MLFGHAHGSVFKMI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2)F |
Computed by PubChem (NCBI)