3-Fluoro-4-(trifluoromethoxy)benzaldehyde, 97%
cas: 473917-15-6 — see every product listed under this CAS number, including other names
3-Fluoro-4-(trifluoromethoxy)benzaldehyde, 97% (CAS 473917-15-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A962691-100mg |
| cas | 473917-15-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 719.77 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 10g | 549.20 Pln | |
| Chemat | 25g | 1168.40 Pln | |
| Chemat | 50g | 2267.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-fluoro-4-(trifluoromethoxy)benzaldehyde (CAS 473917-15-6) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 3-fluoro-4-(trifluoromethoxy)benzaldehyde. InChIKey: RQLRUBHAAVGRPW-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 3-fluoro-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | RQLRUBHAAVGRPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)F)OC(F)(F)F |
Computed by PubChem (NCBI)
