cas: 473917-15-6 — see every product listed under this CAS number, including other names
3-Fluoro-4-(trifluoromethoxy)benzaldehyde, 98% (CAS 473917-15-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065131-1G |
| cas | 473917-15-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 10g | 706.02 Pln | |
| Fluorochem | 25g | 1690.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-fluoro-4-(trifluoromethoxy)benzaldehyde (CAS 473917-15-6) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 3-fluoro-4-(trifluoromethoxy)benzaldehyde. InChIKey: RQLRUBHAAVGRPW-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 3-fluoro-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | RQLRUBHAAVGRPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)F)OC(F)(F)F |
Computed by PubChem (NCBI)