3-Fluoro-4-(trifluoromethyl)benzoyl chloride, 95%
cas: 216144-68-2 — see every product listed under this CAS number, including other names
3-Fluoro-4-(trifluoromethyl)benzoyl chloride, 95% (CAS 216144-68-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A905617-250mg |
| cas | 216144-68-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 520.56 Pln | |
| Ambeed | 25g | 1126.88 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 653.95 Pln | |
| Fluorochem | 25g | 2054.50 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 214.39 Pln | |
| BLDpharm | 5g | 553.16 Pln | |
| BLDpharm | 25g | 1208.49 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-fluoro-4-(trifluoromethyl)benzoyl chloride (CAS 216144-68-2) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 3-fluoro-4-(trifluoromethyl)benzoyl chloride. InChIKey: DPDAEMNQJYDHRQ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 3-fluoro-4-(trifluoromethyl)benzoyl chloride |
| InChIKey | DPDAEMNQJYDHRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)Cl)F)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
3-Fluoro-4-(trifluoromethyl)benzoyl chloride, 3-fluoro-4-(trifluoromethyl)benzoylchloride, Benzoyl chloride, 3-fluoro-4-(trifluoromethyl)-, 3-fluoranyl-4-(trifluoromethyl)benzoyl chloride, 3-Fluoro-4-(trifluoromethyl)benzoyl cloride, 3-fluoro-4-trifluoromethylbenzoyl chloride, 3-fluoro-4-trifluoromethyl benzoyl chloride, 3-fluoro-4-(trifiuoromethyl)benzoyl chloride, 3-Fluoro-4-(trifluoromethyl)benzoyl chloride, 95%