Products 193290-80-1
CAS 193290-80-1 appears in our catalog under these names: 3-Fluoro-4-formylbenzoic acid, 3-Fluoro-4-formylbenzoic acid, 98%, 98%, 3-Fluoro-4-formylbenzoic acid, 95%, 3-Fluoro-4-formylbenzoic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 50g, 250mg, 1g, 5g, 100g.
3-fluoro-4-formylbenzoic acid (CAS 193290-80-1) is a chemical compound with the molecular formula C8H5FO3 and a molecular weight of 168.12 g/mol. IUPAC name: 3-fluoro-4-formylbenzoic acid. InChIKey: GJJKOIYVMNOZSD-UHFFFAOYSA-N.
| Molecular formula | C8H5FO3 |
|---|---|
| Molecular weight | 168.12 g/mol |
| IUPAC name | 3-fluoro-4-formylbenzoic acid |
| InChIKey | GJJKOIYVMNOZSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)F)C=O |
Computed by PubChem (NCBI)