Products 1269496-37-8
CAS 1269496-37-8 appears in our catalog under these names: 3-Fluoro-2-formylbenzoic acid, 95%, 3-fluoro-2-formylbenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
3-fluoro-2-formylbenzoic acid (CAS 1269496-37-8) is a chemical compound with the molecular formula C8H5FO3 and a molecular weight of 168.12 g/mol. IUPAC name: 3-fluoro-2-formylbenzoic acid. InChIKey: JJJVNKHHFHSRSN-UHFFFAOYSA-N.
| Molecular formula | C8H5FO3 |
|---|---|
| Molecular weight | 168.12 g/mol |
| IUPAC name | 3-fluoro-2-formylbenzoic acid |
| InChIKey | JJJVNKHHFHSRSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C=O)C(=O)O |
Computed by PubChem (NCBI)