Products 1289266-50-7
CAS 1289266-50-7 appears in our catalog under these names: 2-Fluoro-6-formylbenzoic acid, 95%, 2-fluoro-6-formylbenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg.
2-fluoro-6-formylbenzoic acid (CAS 1289266-50-7) is a chemical compound with the molecular formula C8H5FO3 and a molecular weight of 168.12 g/mol. IUPAC name: 2-fluoro-6-formylbenzoic acid. InChIKey: UUESLKYWZWGMBV-UHFFFAOYSA-N.
| Molecular formula | C8H5FO3 |
|---|---|
| Molecular weight | 168.12 g/mol |
| IUPAC name | 2-fluoro-6-formylbenzoic acid |
| InChIKey | UUESLKYWZWGMBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)O)C=O |
Computed by PubChem (NCBI)