CAS 724770-53-0 is the registry number for 7-Fluorobenzo(d)(1,3)dioxole-5-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
7-fluoro-1,3-benzodioxole-5-carbaldehyde (CAS 724770-53-0) is a chemical compound with the molecular formula C8H5FO3 and a molecular weight of 168.12 g/mol. IUPAC name: 7-fluoro-1,3-benzodioxole-5-carbaldehyde. InChIKey: NDIFBXNJTOFFAX-UHFFFAOYSA-N.
| Molecular formula | C8H5FO3 |
|---|---|
| Molecular weight | 168.12 g/mol |
| IUPAC name | 7-fluoro-1,3-benzodioxole-5-carbaldehyde |
| InChIKey | NDIFBXNJTOFFAX-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)C=O)F |
Computed by PubChem (NCBI)