Products 1186047-15-3
CAS 1186047-15-3 appears in our catalog under these names: 4-Fluoro-2-formylbenzoic acid, 96%, 4–Fluoro–2–formylbenzoic acid, 4-fluoro-2-formylbenzoic acid, 4-Fluoro-2-formylbenzoic acid 95%, 4-Fluoro-2-formylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 10g, 100mg, 5g, 250mg, 0,5g.
4-fluoro-2-formylbenzoic acid (CAS 1186047-15-3) is a chemical compound with the molecular formula C8H5FO3 and a molecular weight of 168.12 g/mol. IUPAC name: 4-fluoro-2-formylbenzoic acid. InChIKey: KLAAXTKTDRQPOF-UHFFFAOYSA-N.
| Molecular formula | C8H5FO3 |
|---|---|
| Molecular weight | 168.12 g/mol |
| IUPAC name | 4-fluoro-2-formylbenzoic acid |
| InChIKey | KLAAXTKTDRQPOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C=O)C(=O)O |
Computed by PubChem (NCBI)