CAS 97711-49-4 is the registry number for 4-Fluoro-3-hydroxyisobenzofuran-1(3H)-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-3-hydroxy-3H-2-benzofuran-1-one (CAS 97711-49-4) is a chemical compound with the molecular formula C8H5FO3 and a molecular weight of 168.12 g/mol. IUPAC name: 4-fluoro-3-hydroxy-3H-2-benzofuran-1-one. InChIKey: VDEZGLPDQDKMSC-UHFFFAOYSA-N.
| Molecular formula | C8H5FO3 |
|---|---|
| Molecular weight | 168.12 g/mol |
| IUPAC name | 4-fluoro-3-hydroxy-3H-2-benzofuran-1-one |
| InChIKey | VDEZGLPDQDKMSC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(OC2=O)O)C(=C1)F |
Computed by PubChem (NCBI)