3-Fluoro-4-methoxy-5-nitrobenzoic acid, 97%
cas: 577-39-9 — see every product listed under this CAS number, including other names
3-Fluoro-4-methoxy-5-nitrobenzoic acid, 97% (CAS 577-39-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11ELNE-100mg |
| cas | 577-39-9 |
| size | 100mg |
| availability | 8g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 962.00 Pln | |
| Chemat | 5g | 2776.40 Pln | |
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 669.57 Pln | |
| Fluorochem | 1g | 1273.53 Pln | |
| Fluorochem | 5g | 3798.68 Pln | |
| Fluorochem | 10g | 6355.07 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-fluoro-4-methoxy-5-nitrobenzoic acid (CAS 577-39-9) is a chemical compound with the molecular formula C8H6FNO5 and a molecular weight of 215.13 g/mol. IUPAC name: 3-fluoro-4-methoxy-5-nitrobenzoic acid. InChIKey: FZVATVOZGBMDRQ-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO5 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 3-fluoro-4-methoxy-5-nitrobenzoic acid |
| InChIKey | FZVATVOZGBMDRQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1F)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)