CAS 3907-15-1 appears in our catalog under these names: 3–Fluoro–4–methoxybenzoyl chloride, 3-Fluoro-4-methoxybenzoyl chloride, ≥97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 5g, 1g, 25g.
3-fluoro-4-methoxybenzoyl chloride (CAS 3907-15-1) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 3-fluoro-4-methoxybenzoyl chloride. InChIKey: LOSBAHQDKBWMBY-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 3-fluoro-4-methoxybenzoyl chloride |
| InChIKey | LOSBAHQDKBWMBY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)Cl)F |
Computed by PubChem (NCBI)