3-Fluoro-4-methylbenzene-1-sulfonyl chloride 98%
cas: 90260-13-2 — see every product listed under this CAS number, including other names
3-Fluoro-4-methylbenzene-1-sulfonyl chloride 98% (CAS 90260-13-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A558210-1g |
| cas | 90260-13-2 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 648.50 Pln | |
| Ambeed | 10g | 1060.12 Pln | |
| Ambeed | 25g | 2050.25 Pln | |
| Ambeed | 100g | 6678.25 Pln | |
| Ambeed | 500g | 26508.56 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A558210 |
3-fluoro-4-methylbenzenesulfonyl chloride (CAS 90260-13-2) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 3-fluoro-4-methylbenzenesulfonyl chloride. InChIKey: YDUHIMCRFRIVFI-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 3-fluoro-4-methylbenzenesulfonyl chloride |
| InChIKey | YDUHIMCRFRIVFI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)
Synonyms:
3-fluoro-4-methylbenzene-1-sulfonyl chloride, 3-Fluoro-4-methylbenzenesulfonyl chloride, 3-fluoro-4-methylbenzenesulphonyl chloride, Benzenesulfonyl chloride, 3-fluoro-4-methyl-, 3-fluoro-4-methyl-benzenesulfonyl Chloride, 3-fluoro-4-methylbenzene-1-sulfonylchloride, chloro(3-fluoro-4-methylphenyl)sulfone, 3-fluoro-4-methylphenylsulfonyl chloride, Benzenesulfonyl chloride, 3, 3-Fluoro-4-methyl benzenesulfonyl chloride