cas: 90260-13-2 — see every product listed under this CAS number, including other names
3-Fluoro-4-methylbenzenesulfonyl chloride (CAS 90260-13-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013077-1G |
| cas | 90260-13-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 768.50 Pln |
| delivery time | 2-3 weeks |
|---|
3-fluoro-4-methylbenzenesulfonyl chloride (CAS 90260-13-2) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 3-fluoro-4-methylbenzenesulfonyl chloride. InChIKey: YDUHIMCRFRIVFI-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 3-fluoro-4-methylbenzenesulfonyl chloride |
| InChIKey | YDUHIMCRFRIVFI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)