cas: 2369-10-0 — see every product listed under this CAS number, including other names
3-Fluoro-5-nitro-phenol, 98% (CAS 2369-10-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050204-100MG |
| cas | 2369-10-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 284.29 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 5g | 2424.16 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-fluoro-5-nitrophenol (CAS 2369-10-0) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 3-fluoro-5-nitrophenol. InChIKey: YOMAXLMXNGCFRA-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 3-fluoro-5-nitrophenol |
| InChIKey | YOMAXLMXNGCFRA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)