cas: 2369-10-0 — see every product listed under this CAS number, including other names
3-Fluoro-5-nitrophenol, 97%, 97% (CAS 2369-10-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113O6J-100mg |
| cas | 2369-10-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 626.00 Pln | |
| Chemat | 5g | 2315.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-fluoro-5-nitrophenol (CAS 2369-10-0) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 3-fluoro-5-nitrophenol. InChIKey: YOMAXLMXNGCFRA-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 3-fluoro-5-nitrophenol |
| InChIKey | YOMAXLMXNGCFRA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)