3-Fluoro-5-nitroaniline 98%
cas: 2369-12-2 — see every product listed under this CAS number, including other names
3-Fluoro-5-nitroaniline 98% (CAS 2369-12-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A124489-250mg |
| cas | 2369-12-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1171.38 Pln | |
| Ambeed | 10g | 1955.69 Pln | |
| Ambeed | 25g | 3841.38 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A124489 |
3-fluoro-5-nitroaniline (CAS 2369-12-2) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 3-fluoro-5-nitroaniline. InChIKey: OPMFAZASMJCCOQ-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 3-fluoro-5-nitroaniline |
| InChIKey | OPMFAZASMJCCOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])F)N |
Computed by PubChem (NCBI)