cas: 78238-14-9 — see every product listed under this CAS number, including other names
3-HYDROXY-5-NITROBENZOIC ACID, 98%, 98% (CAS 78238-14-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JK2-100mg |
| cas | 78238-14-9 |
| size | 100mg |
| availability | 41g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 309.20 Pln | |
| Chemat | 25g | 582.80 Pln | |
| Chemat | 250mg | 83.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-hydroxy-5-nitrobenzoic acid (CAS 78238-14-9) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 3-hydroxy-5-nitrobenzoic acid. InChIKey: ZVLLYIMPDTXFNC-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-hydroxy-5-nitrobenzoic acid |
| InChIKey | ZVLLYIMPDTXFNC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])O)C(=O)O |
Computed by PubChem (NCBI)