cas: 602-00-6 — see every product listed under this CAS number, including other names
3-Hydroxy-2-nitrobenzoic Acid, 95%, 95% (CAS 602-00-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IANU-250mg |
| cas | 602-00-6 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 275.60 Pln | |
| Chemat | 25g | 597.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-hydroxy-2-nitrobenzoic acid (CAS 602-00-6) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 3-hydroxy-2-nitrobenzoic acid. InChIKey: KPDBKQKRDJPBRM-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-hydroxy-2-nitrobenzoic acid |
| InChIKey | KPDBKQKRDJPBRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)