cas: 6284-92-0 — see every product listed under this CAS number, including other names
3-Hydroxy-4-methoxy-2-nitrobenzaldehyde, 97%, 97% (CAS 6284-92-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E0E4-100mg |
| cas | 6284-92-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 429.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-hydroxy-4-methoxy-2-nitrobenzaldehyde (CAS 6284-92-0) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 3-hydroxy-4-methoxy-2-nitrobenzaldehyde. InChIKey: SJAKQVOAWQEVJV-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 3-hydroxy-4-methoxy-2-nitrobenzaldehyde |
| InChIKey | SJAKQVOAWQEVJV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C=O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)