cas: 143355-56-0 — see every product listed under this CAS number, including other names
3-Hydroxy-7-methoxy-2-naphthoic acid (CAS 143355-56-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240058-100MG |
| cas | 143355-56-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 351.98 Pln |
| delivery time | 3-4 weeks |
|---|
3-hydroxy-7-methoxynaphthalene-2-carboxylic acid (CAS 143355-56-0) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 3-hydroxy-7-methoxynaphthalene-2-carboxylic acid. InChIKey: UDAQUPSJOGVPIX-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 3-hydroxy-7-methoxynaphthalene-2-carboxylic acid |
| InChIKey | UDAQUPSJOGVPIX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC(=C(C=C2C=C1)O)C(=O)O |
Computed by PubChem (NCBI)